C18H20N6O3S2 — CID 55619508
N'-(4-methoxypyrimidin-2-yl)-3-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]propanehydrazide (PubChem CID 55619508) has the molecular formula C18H20N6O3S2 and a molecular weight of 432.53 g/mol. Its IUPAC name is N'-(4-methoxypyrimidin-2-yl)-3-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]propanehydrazide.
| Compound Name | N'-(4-methoxypyrimidin-2-yl)-3-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]propanehydrazide |
|---|---|
| PubChem CID | 55619508 |
| Molecular Formula | C18H20N6O3S2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | N'-(4-methoxypyrimidin-2-yl)-3-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]propanehydrazide |
| SMILES | COc1ccnc(NNC(=O)CCSCc2nc3sc4c(c3c(=O)[nH]2)CCC4)n1 |
| InChI | InChI=1S/C18H20N6O3S2/c1-27-14-5-7-19-18(22-14)24-23-13(25)6-8-28-9-12-20-16(26)15-10-3-2-4-11(10)29-17(15)21-12/h5,7H,2-4,6,8-9H2,1H3,(H,23,25)(H,19,22,24)(H,20,21,26) |
| InChIKey | QYKXJTNSFRVWRF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 121.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|