C25H31N3O2S2 — CID 55993217
3-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methylsulfanyl]-N-[2-(2,4,6-trimethylphenyl)ethyl]propanamide (PubChem CID 55993217) has the molecular formula C25H31N3O2S2 and a molecular weight of 469.68 g/mol. Its IUPAC name is 3-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methylsulfanyl]-N-[2-(2,4,6-trimethylphenyl)ethyl]propanamide.
| Compound Name | 3-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methylsulfanyl]-N-[2-(2,4,6-trimethylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 55993217 |
| Molecular Formula | C25H31N3O2S2 |
| Molecular Weight | 469.68 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 3-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methylsulfanyl]-N-[2-(2,4,6-trimethylphenyl)ethyl]propanamide |
| SMILES | Cc1cc(C)c(CCNC(=O)CCSCc2nc3sc4c(c3c(=O)[nH]2)CCCC4)c(C)c1 |
| InChI | InChI=1S/C25H31N3O2S2/c1-15-12-16(2)18(17(3)13-15)8-10-26-22(29)9-11-31-14-21-27-24(30)23-19-6-4-5-7-20(19)32-25(23)28-21/h12-13H,4-11,14H2,1-3H3,(H,26,29)(H,27,28,30) |
| InChIKey | XPHKHHYKLQSREE-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.68 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|