C19H21N5O3S3 — CID 167759048
2-[[3-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methylsulfanyl]propanoylamino]methyl]-1,3-thiazole-4-carboxamide (PubChem CID 167759048) has the molecular formula C19H21N5O3S3 and a molecular weight of 463.61 g/mol. Its IUPAC name is 2-[[3-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methylsulfanyl]propanoylamino]methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[[3-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methylsulfanyl]propanoylamino]methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 167759048 |
| Molecular Formula | C19H21N5O3S3 |
| Molecular Weight | 463.61 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | 2-[[3-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methylsulfanyl]propanoylamino]methyl]-1,3-thiazole-4-carboxamide |
| SMILES | NC(=O)c1csc(CNC(=O)CCSCc2nc3sc4c(c3c(=O)[nH]2)CCCC4)n1 |
| InChI | InChI=1S/C19H21N5O3S3/c20-17(26)11-8-29-15(22-11)7-21-14(25)5-6-28-9-13-23-18(27)16-10-3-1-2-4-12(10)30-19(16)24-13/h8H,1-7,9H2,(H2,20,26)(H,21,25)(H,23,24,27) |
| InChIKey | JVQALZSPFKOAIQ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.61 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|