C21H21Cl2N3O2S2 — CID 43000045
N-[1-(2,4-dichlorophenyl)ethyl]-3-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]propanamide (PubChem CID 43000045) has the molecular formula C21H21Cl2N3O2S2 and a molecular weight of 482.46 g/mol. Its IUPAC name is N-[1-(2,4-dichlorophenyl)ethyl]-3-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]propanamide.
| Compound Name | N-[1-(2,4-dichlorophenyl)ethyl]-3-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]propanamide |
|---|---|
| PubChem CID | 43000045 |
| Molecular Formula | C21H21Cl2N3O2S2 |
| Molecular Weight | 482.46 g/mol |
| Exact Mass | 481.05 |
| IUPAC Name | N-[1-(2,4-dichlorophenyl)ethyl]-3-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]propanamide |
| SMILES | CC(NC(=O)CCSCc1nc2sc3c(c2c(=O)[nH]1)CCC3)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H21Cl2N3O2S2/c1-11(13-6-5-12(22)9-15(13)23)24-18(27)7-8-29-10-17-25-20(28)19-14-3-2-4-16(14)30-21(19)26-17/h5-6,9,11H,2-4,7-8,10H2,1H3,(H,24,27)(H,25,26,28) |
| InChIKey | LAMKHWNNUBCVMB-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.46 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|