C22H22N6O2S3 — CID 55519976
N-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]-3-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]propanamide (PubChem CID 55519976) has the molecular formula C22H22N6O2S3 and a molecular weight of 498.66 g/mol. Its IUPAC name is N-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]-3-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]propanamide.
| Compound Name | N-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]-3-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]propanamide |
|---|---|
| PubChem CID | 55519976 |
| Molecular Formula | C22H22N6O2S3 |
| Molecular Weight | 498.66 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | N-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]-3-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]propanamide |
| SMILES | Cn1cnnc1Sc1ccc(NC(=O)CCSCc2nc3sc4c(c3c(=O)[nH]2)CCC4)cc1 |
| InChI | InChI=1S/C22H22N6O2S3/c1-28-12-23-27-22(28)32-14-7-5-13(6-8-14)24-18(29)9-10-31-11-17-25-20(30)19-15-3-2-4-16(15)33-21(19)26-17/h5-8,12H,2-4,9-11H2,1H3,(H,24,29)(H,25,26,30) |
| InChIKey | KDBDNNQHCOTOKZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.66 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|