C18H14Cl3N3OS2 — CID 3137185
2-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylsulfanyl)-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 3137185) has the molecular formula C18H14Cl3N3OS2 and a molecular weight of 458.82 g/mol. Its IUPAC name is 2-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylsulfanyl)-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylsulfanyl)-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 3137185 |
| Molecular Formula | C18H14Cl3N3OS2 |
| Molecular Weight | 458.82 g/mol |
| Exact Mass | 456.96 |
| IUPAC Name | 2-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylsulfanyl)-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | O=C(CSc1ncnc2sc3c(c12)CCCC3)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C18H14Cl3N3OS2/c19-10-5-12(21)13(6-11(10)20)24-15(25)7-26-17-16-9-3-1-2-4-14(9)27-18(16)23-8-22-17/h5-6,8H,1-4,7H2,(H,24,25) |
| InChIKey | PFKKVGYTJDISDU-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.82 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|