C18H15ClN4O2S2 — CID 4811733
4-chloro-N'-[2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)acetyl]benzohydrazide (PubChem CID 4811733) has the molecular formula C18H15ClN4O2S2 and a molecular weight of 418.93 g/mol. Its IUPAC name is 4-chloro-N'-[2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)acetyl]benzohydrazide.
| Compound Name | 4-chloro-N'-[2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 4811733 |
| Molecular Formula | C18H15ClN4O2S2 |
| Molecular Weight | 418.93 g/mol |
| Exact Mass | 418.03 |
| IUPAC Name | 4-chloro-N'-[2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)acetyl]benzohydrazide |
| SMILES | O=C(CSc1ncnc2sc3c(c12)CCC3)NNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H15ClN4O2S2/c19-11-6-4-10(5-7-11)16(25)23-22-14(24)8-26-17-15-12-2-1-3-13(12)27-18(15)21-9-20-17/h4-7,9H,1-3,8H2,(H,22,24)(H,23,25) |
| InChIKey | BZPMPQQLPISCAW-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.93 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|