C23H25ClN4O2S2 — CID 3189342
N'-[2-[(7-tert-butyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanyl]acetyl]-4-chlorobenzohydrazide (PubChem CID 3189342) has the molecular formula C23H25ClN4O2S2 and a molecular weight of 489.07 g/mol. Its IUPAC name is N'-[2-[(7-tert-butyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanyl]acetyl]-4-chlorobenzohydrazide.
| Compound Name | N'-[2-[(7-tert-butyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanyl]acetyl]-4-chlorobenzohydrazide |
|---|---|
| PubChem CID | 3189342 |
| Molecular Formula | C23H25ClN4O2S2 |
| Molecular Weight | 489.07 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | N'-[2-[(7-tert-butyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanyl]acetyl]-4-chlorobenzohydrazide |
| SMILES | CC(C)(C)C1CCc2c(sc3ncnc(SCC(=O)NNC(=O)c4ccc(Cl)cc4)c23)C1 |
| InChI | InChI=1S/C23H25ClN4O2S2/c1-23(2,3)14-6-9-16-17(10-14)32-22-19(16)21(25-12-26-22)31-11-18(29)27-28-20(30)13-4-7-15(24)8-5-13/h4-5,7-8,12,14H,6,9-11H2,1-3H3,(H,27,29)(H,28,30) |
| InChIKey | ZIMCIKDEKBIXCD-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.07 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|