C18H14N4OS2 — CID 9333518
2-[(10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-yl)sulfanyl]-5-phenyl-1,3,4-oxadiazole (PubChem CID 9333518) has the molecular formula C18H14N4OS2 and a molecular weight of 366.47 g/mol. Its IUPAC name is 2-[(10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-yl)sulfanyl]-5-phenyl-1,3,4-oxadiazole.
| Compound Name | 2-[(10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-yl)sulfanyl]-5-phenyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 9333518 |
| Molecular Formula | C18H14N4OS2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 2-[(10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-yl)sulfanyl]-5-phenyl-1,3,4-oxadiazole |
| SMILES | Cc1nc(Sc2nnc(-c3ccccc3)o2)c2c3c(sc2n1)CCC3 |
| InChI | InChI=1S/C18H14N4OS2/c1-10-19-16-14(12-8-5-9-13(12)24-16)17(20-10)25-18-22-21-15(23-18)11-6-3-2-4-7-11/h2-4,6-7H,5,8-9H2,1H3 |
| InChIKey | LVGLBUKVMUGGEP-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |