C19H16N4O2S2 — CID 7854802
10-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one (PubChem CID 7854802) has the molecular formula C19H16N4O2S2 and a molecular weight of 396.50 g/mol. Its IUPAC name is 10-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one.
| Compound Name | 10-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one |
|---|---|
| PubChem CID | 7854802 |
| Molecular Formula | C19H16N4O2S2 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | 10-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one |
| SMILES | Cc1ccc(-c2nnc(SCc3nc4sc5c(c4c(=O)[nH]3)CCC5)o2)cc1 |
| InChI | InChI=1S/C19H16N4O2S2/c1-10-5-7-11(8-6-10)17-22-23-19(25-17)26-9-14-20-16(24)15-12-3-2-4-13(12)27-18(15)21-14/h5-8H,2-4,9H2,1H3,(H,20,21,24) |
| InChIKey | XHRFASFXRFCICF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |