C20H19N5OS3 — CID 3873811
2-[[5-(4-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 3873811) has the molecular formula C20H19N5OS3 and a molecular weight of 441.61 g/mol. Its IUPAC name is 2-[[5-(4-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[[5-(4-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 3873811 |
| Molecular Formula | C20H19N5OS3 |
| Molecular Weight | 441.61 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | 2-[[5-(4-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | Cc1ccc(Nc2nnc(SCc3nc4sc5c(c4c(=O)[nH]3)CCCC5)s2)cc1 |
| InChI | InChI=1S/C20H19N5OS3/c1-11-6-8-12(9-7-11)21-19-24-25-20(29-19)27-10-15-22-17(26)16-13-4-2-3-5-14(13)28-18(16)23-15/h6-9H,2-5,10H2,1H3,(H,21,24)(H,22,23,26) |
| InChIKey | KATMENQHDXHVEF-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.61 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |