C13H13N5OS3 — CID 4788768
2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 4788768) has the molecular formula C13H13N5OS3 and a molecular weight of 351.48 g/mol. Its IUPAC name is 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 4788768 |
| Molecular Formula | C13H13N5OS3 |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | Nc1nnc(SCc2nc3sc4c(c3c(=O)[nH]2)CCCC4)s1 |
| InChI | InChI=1S/C13H13N5OS3/c14-12-17-18-13(22-12)20-5-8-15-10(19)9-6-3-1-2-4-7(6)21-11(9)16-8/h1-5H2,(H2,14,17)(H,15,16,19) |
| InChIKey | AVOZRDLNMRNRMW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |