C21H24N2OS2 — CID 7536389
2-[(2,3,5,6-tetramethylphenyl)sulfanylmethyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 7536389) has the molecular formula C21H24N2OS2 and a molecular weight of 384.57 g/mol. Its IUPAC name is 2-[(2,3,5,6-tetramethylphenyl)sulfanylmethyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[(2,3,5,6-tetramethylphenyl)sulfanylmethyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 7536389 |
| Molecular Formula | C21H24N2OS2 |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 2-[(2,3,5,6-tetramethylphenyl)sulfanylmethyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | Cc1cc(C)c(C)c(SCc2nc3sc4c(c3c(=O)[nH]2)CCCC4)c1C |
| InChI | InChI=1S/C21H24N2OS2/c1-11-9-12(2)14(4)19(13(11)3)25-10-17-22-20(24)18-15-7-5-6-8-16(15)26-21(18)23-17/h9H,5-8,10H2,1-4H3,(H,22,23,24) |
| InChIKey | BERAGOJCVXFPTM-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |