C12H11N5OS3 — CID 143287212
10-[(5-amino-1,3,4-thiadiazol-2-yl)methylsulfanyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one (PubChem CID 143287212) has the molecular formula C12H11N5OS3 and a molecular weight of 337.46 g/mol. Its IUPAC name is 10-[(5-amino-1,3,4-thiadiazol-2-yl)methylsulfanyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one.
| Compound Name | 10-[(5-amino-1,3,4-thiadiazol-2-yl)methylsulfanyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one |
|---|---|
| PubChem CID | 143287212 |
| Molecular Formula | C12H11N5OS3 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.01 |
| IUPAC Name | 10-[(5-amino-1,3,4-thiadiazol-2-yl)methylsulfanyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one |
| SMILES | Nc1nnc(CSc2nc3sc4c(c3c(=O)[nH]2)CCC4)s1 |
| InChI | InChI=1S/C12H11N5OS3/c13-11-17-16-7(21-11)4-19-12-14-9(18)8-5-2-1-3-6(5)20-10(8)15-12/h1-4H2,(H2,13,17)(H,14,15,18) |
| InChIKey | QLEPSKZOPBOJIT-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |