C19H17N5OS3 — CID 21235232
2-[(5-anilino-1,3,4-thiadiazol-2-yl)methylsulfanyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 21235232) has the molecular formula C19H17N5OS3 and a molecular weight of 427.58 g/mol. Its IUPAC name is 2-[(5-anilino-1,3,4-thiadiazol-2-yl)methylsulfanyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[(5-anilino-1,3,4-thiadiazol-2-yl)methylsulfanyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 21235232 |
| Molecular Formula | C19H17N5OS3 |
| Molecular Weight | 427.58 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | 2-[(5-anilino-1,3,4-thiadiazol-2-yl)methylsulfanyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(SCc2nnc(Nc3ccccc3)s2)nc2sc3c(c12)CCCC3 |
| InChI | InChI=1S/C19H17N5OS3/c25-16-15-12-8-4-5-9-13(12)27-17(15)22-18(21-16)26-10-14-23-24-19(28-14)20-11-6-2-1-3-7-11/h1-3,6-7H,4-5,8-10H2,(H,20,24)(H,21,22,25) |
| InChIKey | AGRZLMNYTFXCKE-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.58 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |