C18H15N3O3S2 — CID 75388217
2-[[5-(furan-2-yl)-1,2-oxazol-4-yl]methylsulfanyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 75388217) has the molecular formula C18H15N3O3S2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 2-[[5-(furan-2-yl)-1,2-oxazol-4-yl]methylsulfanyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[[5-(furan-2-yl)-1,2-oxazol-4-yl]methylsulfanyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 75388217 |
| Molecular Formula | C18H15N3O3S2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | 2-[[5-(furan-2-yl)-1,2-oxazol-4-yl]methylsulfanyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(SCc2cnoc2-c2ccco2)nc2sc3c(c12)CCCC3 |
| InChI | InChI=1S/C18H15N3O3S2/c22-16-14-11-4-1-2-6-13(11)26-17(14)21-18(20-16)25-9-10-8-19-24-15(10)12-5-3-7-23-12/h3,5,7-8H,1-2,4,6,9H2,(H,20,21,22) |
| InChIKey | GQSAKSUDNPKICV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 84.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |