C18H16N6O2S2 — CID 8002954
2-[[4-amino-6-(furan-2-yl)-1,3,5-triazin-2-yl]sulfanylmethyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 8002954) has the molecular formula C18H16N6O2S2 and a molecular weight of 412.50 g/mol. Its IUPAC name is 2-[[4-amino-6-(furan-2-yl)-1,3,5-triazin-2-yl]sulfanylmethyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[[4-amino-6-(furan-2-yl)-1,3,5-triazin-2-yl]sulfanylmethyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 8002954 |
| Molecular Formula | C18H16N6O2S2 |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 2-[[4-amino-6-(furan-2-yl)-1,3,5-triazin-2-yl]sulfanylmethyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | Nc1nc(SCc2nc3sc4c(c3c(=O)[nH]2)CCCC4)nc(-c2ccco2)n1 |
| InChI | InChI=1S/C18H16N6O2S2/c19-17-22-14(10-5-3-7-26-10)23-18(24-17)27-8-12-20-15(25)13-9-4-1-2-6-11(9)28-16(13)21-12/h3,5,7H,1-2,4,6,8H2,(H,20,21,25)(H2,19,22,23,24) |
| InChIKey | MTMXLCPUIJKVSY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thio_pyridine_A(1)', 'substructure': 'N/A'} |
|---|