C18H16N6OS2 — CID 124568259
2-[(5-pyridin-2-yl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 124568259) has the molecular formula C18H16N6OS2 and a molecular weight of 396.50 g/mol. Its IUPAC name is 2-[(5-pyridin-2-yl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[(5-pyridin-2-yl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 124568259 |
| Molecular Formula | C18H16N6OS2 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 2-[(5-pyridin-2-yl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(CSc2n[nH]c(-c3ccccn3)n2)nc2sc3c(c12)CCCC3 |
| InChI | InChI=1S/C18H16N6OS2/c25-16-14-10-5-1-2-7-12(10)27-17(14)21-13(20-16)9-26-18-22-15(23-24-18)11-6-3-4-8-19-11/h3-4,6,8H,1-2,5,7,9H2,(H,20,21,25)(H,22,23,24) |
| InChIKey | FMWLPPRAQJLSII-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |