C19H21N5O2S4 — CID 4784761
2-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methylsulfanyl]-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide (PubChem CID 4784761) has the molecular formula C19H21N5O2S4 and a molecular weight of 479.68 g/mol. Its IUPAC name is 2-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methylsulfanyl]-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide.
| Compound Name | 2-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methylsulfanyl]-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 4784761 |
| Molecular Formula | C19H21N5O2S4 |
| Molecular Weight | 479.68 g/mol |
| Exact Mass | 479.06 |
| IUPAC Name | 2-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methylsulfanyl]-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide |
| SMILES | C=CCSc1nnc(NC(=O)C(C)SCc2nc3sc4c(c3c(=O)[nH]2)CCCC4)s1 |
| InChI | InChI=1S/C19H21N5O2S4/c1-3-8-27-19-24-23-18(30-19)22-15(25)10(2)28-9-13-20-16(26)14-11-6-4-5-7-12(11)29-17(14)21-13/h3,10H,1,4-9H2,2H3,(H,20,21,26)(H,22,23,25) |
| InChIKey | YMLIQWJLZASIQC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.68 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|