C22H23N5O2S3 — CID 4032380
2-[[5-(2-ethoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-7-methyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 4032380) has the molecular formula C22H23N5O2S3 and a molecular weight of 485.66 g/mol. Its IUPAC name is 2-[[5-(2-ethoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-7-methyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[[5-(2-ethoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-7-methyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 4032380 |
| Molecular Formula | C22H23N5O2S3 |
| Molecular Weight | 485.66 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | 2-[[5-(2-ethoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-7-methyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CCOc1ccccc1Nc1nnc(SCc2nc3sc4c(c3c(=O)[nH]2)CCC(C)C4)s1 |
| InChI | InChI=1S/C22H23N5O2S3/c1-3-29-15-7-5-4-6-14(15)23-21-26-27-22(32-21)30-11-17-24-19(28)18-13-9-8-12(2)10-16(13)31-20(18)25-17/h4-7,12H,3,8-11H2,1-2H3,(H,23,26)(H,24,25,28) |
| InChIKey | VWWHCBBISHCFBU-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.66 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |