C14H14N4OS3 — CID 2460160
(7R)-7-methyl-2-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 2460160) has the molecular formula C14H14N4OS3 and a molecular weight of 350.49 g/mol. Its IUPAC name is (7R)-7-methyl-2-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | (7R)-7-methyl-2-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 2460160 |
| Molecular Formula | C14H14N4OS3 |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | (7R)-7-methyl-2-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | C[C@@H]1CCc2c(sc3nc(CSc4nncs4)[nH]c(=O)c23)C1 |
| InChI | InChI=1S/C14H14N4OS3/c1-7-2-3-8-9(4-7)22-13-11(8)12(19)16-10(17-13)5-20-14-18-15-6-21-14/h6-7H,2-5H2,1H3,(H,16,17,19)/t7-/m1/s1 |
| InChIKey | IPTDMVZUJJHCHP-SSDOTTSWSA-N |
| XLogP | 3.25 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |