C20H20N6OS2 — CID 2460231
(7S)-7-methyl-2-[(4-methyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanylmethyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 2460231) has the molecular formula C20H20N6OS2 and a molecular weight of 424.56 g/mol. Its IUPAC name is (7S)-7-methyl-2-[(4-methyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanylmethyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | (7S)-7-methyl-2-[(4-methyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanylmethyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 2460231 |
| Molecular Formula | C20H20N6OS2 |
| Molecular Weight | 424.56 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | (7S)-7-methyl-2-[(4-methyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanylmethyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | C[C@H]1CCc2c(sc3nc(CSc4nnc(-c5ccncc5)n4C)[nH]c(=O)c23)C1 |
| InChI | InChI=1S/C20H20N6OS2/c1-11-3-4-13-14(9-11)29-19-16(13)18(27)22-15(23-19)10-28-20-25-24-17(26(20)2)12-5-7-21-8-6-12/h5-8,11H,3-4,9-10H2,1-2H3,(H,22,23,27)/t11-/m0/s1 |
| InChIKey | AAXHZSRSQJWBRP-NSHDSACASA-N |
| XLogP | 3.59 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.56 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |