C14H16N6OS2 — CID 2390483
(7S)-2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-7-methyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 2390483) has the molecular formula C14H16N6OS2 and a molecular weight of 348.46 g/mol. Its IUPAC name is (7S)-2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-7-methyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | (7S)-2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-7-methyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 2390483 |
| Molecular Formula | C14H16N6OS2 |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | (7S)-2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-7-methyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | C[C@H]1CCc2c(sc3nc(CSc4n[nH]c(N)n4)[nH]c(=O)c23)C1 |
| InChI | InChI=1S/C14H16N6OS2/c1-6-2-3-7-8(4-6)23-12-10(7)11(21)16-9(17-12)5-22-14-18-13(15)19-20-14/h6H,2-5H2,1H3,(H,16,17,21)(H3,15,18,19,20)/t6-/m0/s1 |
| InChIKey | QNDRAULMPFXYMZ-LURJTMIESA-N |
| XLogP | 2.10 |
| TPSA | 113.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |