C15H20N4OS2 — CID 8866244
[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]methyl N,N'-dimethylcarbamimidothioate (PubChem CID 8866244) has the molecular formula C15H20N4OS2 and a molecular weight of 336.49 g/mol. Its IUPAC name is [(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]methyl N,N'-dimethylcarbamimidothioate.
| Compound Name | [(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]methyl N,N'-dimethylcarbamimidothioate |
|---|---|
| PubChem CID | 8866244 |
| Molecular Formula | C15H20N4OS2 |
| Molecular Weight | 336.49 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | [(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]methyl N,N'-dimethylcarbamimidothioate |
| SMILES | C/N=C(\NC)SCc1nc2sc3c(c2c(=O)[nH]1)CC[C@@H](C)C3 |
| InChI | InChI=1S/C15H20N4OS2/c1-8-4-5-9-10(6-8)22-14-12(9)13(20)18-11(19-14)7-21-15(16-2)17-3/h8H,4-7H2,1-3H3,(H,16,17)(H,18,19,20)/t8-/m1/s1 |
| InChIKey | ULMPTFMXUKZVLW-MRVPVSSYSA-N |
| XLogP | 2.55 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.49 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|