C18H16N4OS3 — CID 3883741
7-methyl-2-(thieno[2,3-d]pyrimidin-4-ylsulfanylmethyl)-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 3883741) has the molecular formula C18H16N4OS3 and a molecular weight of 400.55 g/mol. Its IUPAC name is 7-methyl-2-(thieno[2,3-d]pyrimidin-4-ylsulfanylmethyl)-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 7-methyl-2-(thieno[2,3-d]pyrimidin-4-ylsulfanylmethyl)-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 3883741 |
| Molecular Formula | C18H16N4OS3 |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | 7-methyl-2-(thieno[2,3-d]pyrimidin-4-ylsulfanylmethyl)-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CC1CCc2c(sc3nc(CSc4ncnc5sccc45)[nH]c(=O)c23)C1 |
| InChI | InChI=1S/C18H16N4OS3/c1-9-2-3-10-12(6-9)26-18-14(10)15(23)21-13(22-18)7-25-17-11-4-5-24-16(11)19-8-20-17/h4-5,8-9H,2-3,6-7H2,1H3,(H,21,22,23) |
| InChIKey | YSFCZMTUUHFOPO-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |