C20H20N4OS3 — CID 41124062
(7S)-2-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylmethyl]-7-methyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 41124062) has the molecular formula C20H20N4OS3 and a molecular weight of 428.61 g/mol. Its IUPAC name is (7S)-2-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylmethyl]-7-methyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | (7S)-2-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylmethyl]-7-methyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 41124062 |
| Molecular Formula | C20H20N4OS3 |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | (7S)-2-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylmethyl]-7-methyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | Cc1sc2ncnc(SCc3nc4sc5c(c4c(=O)[nH]3)CC[C@H](C)C5)c2c1C |
| InChI | InChI=1S/C20H20N4OS3/c1-9-4-5-12-13(6-9)28-20-16(12)17(25)23-14(24-20)7-26-18-15-10(2)11(3)27-19(15)22-8-21-18/h8-9H,4-7H2,1-3H3,(H,23,24,25)/t9-/m0/s1 |
| InChIKey | KKPSLKFVKKZRJR-VIFPVBQESA-N |
| XLogP | 5.02 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |