C19H14N4O4S2 — CID 29201816
10-[[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one (PubChem CID 29201816) has the molecular formula C19H14N4O4S2 and a molecular weight of 426.48 g/mol. Its IUPAC name is 10-[[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one.
| Compound Name | 10-[[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one |
|---|---|
| PubChem CID | 29201816 |
| Molecular Formula | C19H14N4O4S2 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | 10-[[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one |
| SMILES | O=c1[nH]c(CSc2nnc(-c3ccc4c(c3)OCO4)o2)nc2sc3c(c12)CCC3 |
| InChI | InChI=1S/C19H14N4O4S2/c24-16-15-10-2-1-3-13(10)29-18(15)21-14(20-16)7-28-19-23-22-17(27-19)9-4-5-11-12(6-9)26-8-25-11/h4-6H,1-3,7-8H2,(H,20,21,24) |
| InChIKey | VMIBDJHARCHXPY-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 103.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |