C21H21N3O4S2 — CID 24610189
N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]acetamide (PubChem CID 24610189) has the molecular formula C21H21N3O4S2 and a molecular weight of 443.55 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]acetamide.
| Compound Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 24610189 |
| Molecular Formula | C21H21N3O4S2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]acetamide |
| SMILES | CC(NC(=O)CSCc1nc2sc3c(c2c(=O)[nH]1)CCC3)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H21N3O4S2/c1-11(12-5-6-14-15(7-12)28-10-27-14)22-18(25)9-29-8-17-23-20(26)19-13-3-2-4-16(13)30-21(19)24-17/h5-7,11H,2-4,8-10H2,1H3,(H,22,25)(H,23,24,26) |
| InChIKey | DEIBCHBXCSEDKS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |