C23H25N5O2S2 — CID 4042702
10-[[4-butyl-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one (PubChem CID 4042702) has the molecular formula C23H25N5O2S2 and a molecular weight of 467.62 g/mol. Its IUPAC name is 10-[[4-butyl-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one.
| Compound Name | 10-[[4-butyl-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one |
|---|---|
| PubChem CID | 4042702 |
| Molecular Formula | C23H25N5O2S2 |
| Molecular Weight | 467.62 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | 10-[[4-butyl-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one |
| SMILES | CCCCn1c(SCc2nc3sc4c(c3c(=O)[nH]2)CCC4)nnc1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C23H25N5O2S2/c1-3-4-12-28-20(14-8-10-15(30-2)11-9-14)26-27-23(28)31-13-18-24-21(29)19-16-6-5-7-17(16)32-22(19)25-18/h8-11H,3-7,12-13H2,1-2H3,(H,24,25,29) |
| InChIKey | OMMXYLMBZZHRBN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.62 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |