C15H17N5O2S2 — CID 7421779
10-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one (PubChem CID 7421779) has the molecular formula C15H17N5O2S2 and a molecular weight of 363.47 g/mol. Its IUPAC name is 10-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one.
| Compound Name | 10-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one |
|---|---|
| PubChem CID | 7421779 |
| Molecular Formula | C15H17N5O2S2 |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 10-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one |
| SMILES | CCCn1c(SCc2nc3sc4c(c3c(=O)[nH]2)CCC4)n[nH]c1=O |
| InChI | InChI=1S/C15H17N5O2S2/c1-2-6-20-14(22)18-19-15(20)23-7-10-16-12(21)11-8-4-3-5-9(8)24-13(11)17-10/h2-7H2,1H3,(H,18,22)(H,16,17,21) |
| InChIKey | KXVIJLZDAXNUCB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 96.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |