C17H12N4OS — CID 3798588
2-(3-methylquinoxalin-2-yl)sulfanyl-5-phenyl-1,3,4-oxadiazole (PubChem CID 3798588) has the molecular formula C17H12N4OS and a molecular weight of 320.38 g/mol. Its IUPAC name is 2-(3-methylquinoxalin-2-yl)sulfanyl-5-phenyl-1,3,4-oxadiazole.
| Compound Name | 2-(3-methylquinoxalin-2-yl)sulfanyl-5-phenyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 3798588 |
| Molecular Formula | C17H12N4OS |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 2-(3-methylquinoxalin-2-yl)sulfanyl-5-phenyl-1,3,4-oxadiazole |
| SMILES | Cc1nc2ccccc2nc1Sc1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C17H12N4OS/c1-11-16(19-14-10-6-5-9-13(14)18-11)23-17-21-20-15(22-17)12-7-3-2-4-8-12/h2-10H,1H3 |
| InChIKey | KOHPWBAEVNSKAC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |