C24H22N5S+ — CID 7642571
13-benzyl-7-methyl-4-phenyl-10-thia-3,5,6,8-tetraza-13-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene (PubChem CID 7642571) has the molecular formula C24H22N5S+ and a molecular weight of 412.54 g/mol. Its IUPAC name is 13-benzyl-7-methyl-4-phenyl-10-thia-3,5,6,8-tetraza-13-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene.
| Compound Name | 13-benzyl-7-methyl-4-phenyl-10-thia-3,5,6,8-tetraza-13-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
|---|---|
| PubChem CID | 7642571 |
| Molecular Formula | C24H22N5S+ |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 13-benzyl-7-methyl-4-phenyl-10-thia-3,5,6,8-tetraza-13-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
| SMILES | Cc1nc2sc3c(c2c2nc(-c4ccccc4)nn12)CC[NH+](Cc1ccccc1)C3 |
| InChI | InChI=1S/C24H21N5S/c1-16-25-24-21(23-26-22(27-29(16)23)18-10-6-3-7-11-18)19-12-13-28(15-20(19)30-24)14-17-8-4-2-5-9-17/h2-11H,12-15H2,1H3/p+1 |
| InChIKey | MMCFBZPNEXHQJD-UHFFFAOYSA-O |
| XLogP | 3.46 |
| TPSA | 47.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |