C17H16N4OS — CID 2034818
(14R)-4-(furan-2-yl)-7,14-dimethyl-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene (PubChem CID 2034818) has the molecular formula C17H16N4OS and a molecular weight of 324.41 g/mol. Its IUPAC name is (14R)-4-(furan-2-yl)-7,14-dimethyl-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene.
| Compound Name | (14R)-4-(furan-2-yl)-7,14-dimethyl-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
|---|---|
| PubChem CID | 2034818 |
| Molecular Formula | C17H16N4OS |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | (14R)-4-(furan-2-yl)-7,14-dimethyl-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
| SMILES | Cc1nc2sc3c(c2c2nc(-c4ccco4)nn12)C[C@H](C)CC3 |
| InChI | InChI=1S/C17H16N4OS/c1-9-5-6-13-11(8-9)14-16-19-15(12-4-3-7-22-12)20-21(16)10(2)18-17(14)23-13/h3-4,7,9H,5-6,8H2,1-2H3/t9-/m1/s1 |
| InChIKey | UJAVOTVBBMESEH-SECBINFHSA-N |
| XLogP | 4.03 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |