C12H12N4S — CID 4890563
14-methyl-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene (PubChem CID 4890563) has the molecular formula C12H12N4S and a molecular weight of 244.32 g/mol. Its IUPAC name is 14-methyl-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene.
| Compound Name | 14-methyl-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
|---|---|
| PubChem CID | 4890563 |
| Molecular Formula | C12H12N4S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 14-methyl-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
| SMILES | CC1CCc2sc3ncn4ncnc4c3c2C1 |
| InChI | InChI=1S/C12H12N4S/c1-7-2-3-9-8(4-7)10-11-13-5-15-16(11)6-14-12(10)17-9/h5-7H,2-4H2,1H3 |
| InChIKey | OLGDKHOCGGSFNT-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |