C14H14N6S — CID 4223261
3,15-dimethyl-19-thia-2,4,5,7,8,10-hexazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),3,5,8,10,13(18)-hexaene (PubChem CID 4223261) has the molecular formula C14H14N6S and a molecular weight of 298.38 g/mol. Its IUPAC name is 3,15-dimethyl-19-thia-2,4,5,7,8,10-hexazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),3,5,8,10,13(18)-hexaene.
| Compound Name | 3,15-dimethyl-19-thia-2,4,5,7,8,10-hexazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),3,5,8,10,13(18)-hexaene |
|---|---|
| PubChem CID | 4223261 |
| Molecular Formula | C14H14N6S |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 3,15-dimethyl-19-thia-2,4,5,7,8,10-hexazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),3,5,8,10,13(18)-hexaene |
| SMILES | Cc1nnc2n3ncnc3c3c4c(sc3n12)CCC(C)C4 |
| InChI | InChI=1S/C14H14N6S/c1-7-3-4-10-9(5-7)11-12-15-6-16-20(12)14-18-17-8(2)19(14)13(11)21-10/h6-7H,3-5H2,1-2H3 |
| InChIKey | CDLDOSOXPXBNEW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 60.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |