C19H18N4S2 — CID 2002578
(14S)-7-benzylsulfanyl-14-methyl-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene (PubChem CID 2002578) has the molecular formula C19H18N4S2 and a molecular weight of 366.52 g/mol. Its IUPAC name is (14S)-7-benzylsulfanyl-14-methyl-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene.
| Compound Name | (14S)-7-benzylsulfanyl-14-methyl-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
|---|---|
| PubChem CID | 2002578 |
| Molecular Formula | C19H18N4S2 |
| Molecular Weight | 366.52 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | (14S)-7-benzylsulfanyl-14-methyl-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
| SMILES | C[C@H]1CCc2sc3nc(SCc4ccccc4)n4ncnc4c3c2C1 |
| InChI | InChI=1S/C19H18N4S2/c1-12-7-8-15-14(9-12)16-17-20-11-21-23(17)19(22-18(16)25-15)24-10-13-5-3-2-4-6-13/h2-6,11-12H,7-10H2,1H3/t12-/m0/s1 |
| InChIKey | HDMWBGGQLSPDGQ-LBPRGKRZSA-N |
| XLogP | 4.76 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.52 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |