C22H19N6OS+ — CID 7380812
13-benzyl-7-phenyl-16-thia-2,3,4,5,7-pentaza-13-azoniatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-8-one (PubChem CID 7380812) has the molecular formula C22H19N6OS+ and a molecular weight of 415.50 g/mol. Its IUPAC name is 13-benzyl-7-phenyl-16-thia-2,3,4,5,7-pentaza-13-azoniatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-8-one.
| Compound Name | 13-benzyl-7-phenyl-16-thia-2,3,4,5,7-pentaza-13-azoniatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-8-one |
|---|---|
| PubChem CID | 7380812 |
| Molecular Formula | C22H19N6OS+ |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 13-benzyl-7-phenyl-16-thia-2,3,4,5,7-pentaza-13-azoniatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-8-one |
| SMILES | O=c1c2c3c(sc2n2nnnc2n1-c1ccccc1)C[NH+](Cc1ccccc1)CC3 |
| InChI | InChI=1S/C22H18N6OS/c29-20-19-17-11-12-26(13-15-7-3-1-4-8-15)14-18(17)30-21(19)28-22(23-24-25-28)27(20)16-9-5-2-6-10-16/h1-10H,11-14H2/p+1 |
| InChIKey | ZATSMHHJMIEHMD-UHFFFAOYSA-O |
| XLogP | 1.63 |
| TPSA | 69.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |