C19H16N4O2S — CID 171987417
5-methyl-8-phenyl-17-thia-2,4,6,8-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),4,6,11(16)-tetraene-3,9-dione (PubChem CID 171987417) has the molecular formula C19H16N4O2S and a molecular weight of 364.43 g/mol. Its IUPAC name is 5-methyl-8-phenyl-17-thia-2,4,6,8-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),4,6,11(16)-tetraene-3,9-dione.
| Compound Name | 5-methyl-8-phenyl-17-thia-2,4,6,8-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),4,6,11(16)-tetraene-3,9-dione |
|---|---|
| PubChem CID | 171987417 |
| Molecular Formula | C19H16N4O2S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 5-methyl-8-phenyl-17-thia-2,4,6,8-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),4,6,11(16)-tetraene-3,9-dione |
| SMILES | Cc1nc(=O)n2c3sc4c(c3c(=O)n(-c3ccccc3)c2n1)CCCC4 |
| InChI | InChI=1S/C19H16N4O2S/c1-11-20-18-22(12-7-3-2-4-8-12)16(24)15-13-9-5-6-10-14(13)26-17(15)23(18)19(25)21-11/h2-4,7-8H,5-6,9-10H2,1H3 |
| InChIKey | APGUNSGVRCFALQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 69.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |