C17H14N4OS — CID 917134
7-(4-methylphenyl)-15-thia-2,4,5,7-tetrazatetracyclo[7.6.0.02,6.010,14]pentadeca-1(9),3,5,10(14)-tetraen-8-one (PubChem CID 917134) has the molecular formula C17H14N4OS and a molecular weight of 322.39 g/mol. Its IUPAC name is 7-(4-methylphenyl)-15-thia-2,4,5,7-tetrazatetracyclo[7.6.0.02,6.010,14]pentadeca-1(9),3,5,10(14)-tetraen-8-one.
| Compound Name | 7-(4-methylphenyl)-15-thia-2,4,5,7-tetrazatetracyclo[7.6.0.02,6.010,14]pentadeca-1(9),3,5,10(14)-tetraen-8-one |
|---|---|
| PubChem CID | 917134 |
| Molecular Formula | C17H14N4OS |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 7-(4-methylphenyl)-15-thia-2,4,5,7-tetrazatetracyclo[7.6.0.02,6.010,14]pentadeca-1(9),3,5,10(14)-tetraen-8-one |
| SMILES | Cc1ccc(-n2c(=O)c3c4c(sc3n3cnnc23)CCC4)cc1 |
| InChI | InChI=1S/C17H14N4OS/c1-10-5-7-11(8-6-10)21-15(22)14-12-3-2-4-13(12)23-16(14)20-9-18-19-17(20)21/h5-9H,2-4H2,1H3 |
| InChIKey | QGNLSTDWQXJVHR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |