C26H26N2O2S — CID 22423487
11-(3,4-dimethylphenyl)-9-[(2,5-dimethylphenyl)methyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6)-diene-10,12-dione (PubChem CID 22423487) has the molecular formula C26H26N2O2S and a molecular weight of 430.57 g/mol. Its IUPAC name is 11-(3,4-dimethylphenyl)-9-[(2,5-dimethylphenyl)methyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6)-diene-10,12-dione.
| Compound Name | 11-(3,4-dimethylphenyl)-9-[(2,5-dimethylphenyl)methyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6)-diene-10,12-dione |
|---|---|
| PubChem CID | 22423487 |
| Molecular Formula | C26H26N2O2S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 11-(3,4-dimethylphenyl)-9-[(2,5-dimethylphenyl)methyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6)-diene-10,12-dione |
| SMILES | Cc1ccc(C)c(Cn2c(=O)n(-c3ccc(C)c(C)c3)c(=O)c3c4c(sc32)CCC4)c1 |
| InChI | InChI=1S/C26H26N2O2S/c1-15-8-9-17(3)19(12-15)14-27-25-23(21-6-5-7-22(21)31-25)24(29)28(26(27)30)20-11-10-16(2)18(4)13-20/h8-13H,5-7,14H2,1-4H3 |
| InChIKey | CXXSWUNVYSVINU-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |