C25H23ClN2O2S — CID 22429298
3-(4-chlorophenyl)-1-[(2,4-dimethylphenyl)methyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2,4-dione (PubChem CID 22429298) has the molecular formula C25H23ClN2O2S and a molecular weight of 450.99 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-[(2,4-dimethylphenyl)methyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 3-(4-chlorophenyl)-1-[(2,4-dimethylphenyl)methyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 22429298 |
| Molecular Formula | C25H23ClN2O2S |
| Molecular Weight | 450.99 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 3-(4-chlorophenyl)-1-[(2,4-dimethylphenyl)methyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2,4-dione |
| SMILES | Cc1ccc(Cn2c(=O)n(-c3ccc(Cl)cc3)c(=O)c3c4c(sc32)CCCC4)c(C)c1 |
| InChI | InChI=1S/C25H23ClN2O2S/c1-15-7-8-17(16(2)13-15)14-27-24-22(20-5-3-4-6-21(20)31-24)23(29)28(25(27)30)19-11-9-18(26)10-12-19/h7-13H,3-6,14H2,1-2H3 |
| InChIKey | NXBQDBVBYKRESE-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.99 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |