C24H21FN2O2S — CID 15988024
11-(3,4-dimethylphenyl)-9-[(2-fluorophenyl)methyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6)-diene-10,12-dione (PubChem CID 15988024) has the molecular formula C24H21FN2O2S and a molecular weight of 420.51 g/mol. Its IUPAC name is 11-(3,4-dimethylphenyl)-9-[(2-fluorophenyl)methyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6)-diene-10,12-dione.
| Compound Name | 11-(3,4-dimethylphenyl)-9-[(2-fluorophenyl)methyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6)-diene-10,12-dione |
|---|---|
| PubChem CID | 15988024 |
| Molecular Formula | C24H21FN2O2S |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 11-(3,4-dimethylphenyl)-9-[(2-fluorophenyl)methyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6)-diene-10,12-dione |
| SMILES | Cc1ccc(-n2c(=O)c3c4c(sc3n(Cc3ccccc3F)c2=O)CCC4)cc1C |
| InChI | InChI=1S/C24H21FN2O2S/c1-14-10-11-17(12-15(14)2)27-22(28)21-18-7-5-9-20(18)30-23(21)26(24(27)29)13-16-6-3-4-8-19(16)25/h3-4,6,8,10-12H,5,7,9,13H2,1-2H3 |
| InChIKey | ZWYDJQICYCMPLQ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |