C18H16N4OS2 — CID 1387645
7-(3-methylphenyl)-3-methylsulfanyl-15-thia-2,4,5,7-tetrazatetracyclo[7.6.0.02,6.010,14]pentadeca-1(9),3,5,10(14)-tetraen-8-one (PubChem CID 1387645) has the molecular formula C18H16N4OS2 and a molecular weight of 368.49 g/mol. Its IUPAC name is 7-(3-methylphenyl)-3-methylsulfanyl-15-thia-2,4,5,7-tetrazatetracyclo[7.6.0.02,6.010,14]pentadeca-1(9),3,5,10(14)-tetraen-8-one.
| Compound Name | 7-(3-methylphenyl)-3-methylsulfanyl-15-thia-2,4,5,7-tetrazatetracyclo[7.6.0.02,6.010,14]pentadeca-1(9),3,5,10(14)-tetraen-8-one |
|---|---|
| PubChem CID | 1387645 |
| Molecular Formula | C18H16N4OS2 |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 7-(3-methylphenyl)-3-methylsulfanyl-15-thia-2,4,5,7-tetrazatetracyclo[7.6.0.02,6.010,14]pentadeca-1(9),3,5,10(14)-tetraen-8-one |
| SMILES | CSc1nnc2n(-c3cccc(C)c3)c(=O)c3c4c(sc3n12)CCC4 |
| InChI | InChI=1S/C18H16N4OS2/c1-10-5-3-6-11(9-10)21-15(23)14-12-7-4-8-13(12)25-16(14)22-17(21)19-20-18(22)24-2/h3,5-6,9H,4,7-8H2,1-2H3 |
| InChIKey | NAPLPYXDPCQMCN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |