C17H14ClN5OS — CID 44512694
3-amino-7-(4-chlorophenyl)-16-thia-2,4,5,7-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-8-one (PubChem CID 44512694) has the molecular formula C17H14ClN5OS and a molecular weight of 371.85 g/mol. Its IUPAC name is 3-amino-7-(4-chlorophenyl)-16-thia-2,4,5,7-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-8-one.
| Compound Name | 3-amino-7-(4-chlorophenyl)-16-thia-2,4,5,7-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-8-one |
|---|---|
| PubChem CID | 44512694 |
| Molecular Formula | C17H14ClN5OS |
| Molecular Weight | 371.85 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | 3-amino-7-(4-chlorophenyl)-16-thia-2,4,5,7-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-8-one |
| SMILES | Nc1nnc2n(-c3ccc(Cl)cc3)c(=O)c3c4c(sc3n12)CCCC4 |
| InChI | InChI=1S/C17H14ClN5OS/c18-9-5-7-10(8-6-9)22-14(24)13-11-3-1-2-4-12(11)25-15(13)23-16(19)20-21-17(22)23/h5-8H,1-4H2,(H2,19,20) |
| InChIKey | UDIQFOMCXCDTLF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 78.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.85 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |