C30H32N6O2S — CID 46203775
3-[[4-(2-ethoxyphenyl)piperazin-1-yl]methyl]-7-phenyl-16-thia-2,4,5,7-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-8-one (PubChem CID 46203775) has the molecular formula C30H32N6O2S and a molecular weight of 540.69 g/mol. Its IUPAC name is 3-[[4-(2-ethoxyphenyl)piperazin-1-yl]methyl]-7-phenyl-16-thia-2,4,5,7-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-8-one.
| Compound Name | 3-[[4-(2-ethoxyphenyl)piperazin-1-yl]methyl]-7-phenyl-16-thia-2,4,5,7-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-8-one |
|---|---|
| PubChem CID | 46203775 |
| Molecular Formula | C30H32N6O2S |
| Molecular Weight | 540.69 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | 3-[[4-(2-ethoxyphenyl)piperazin-1-yl]methyl]-7-phenyl-16-thia-2,4,5,7-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-8-one |
| SMILES | CCOc1ccccc1N1CCN(Cc2nnc3n(-c4ccccc4)c(=O)c4c5c(sc4n23)CCCC5)CC1 |
| InChI | InChI=1S/C30H32N6O2S/c1-2-38-24-14-8-7-13-23(24)34-18-16-33(17-19-34)20-26-31-32-30-35(21-10-4-3-5-11-21)28(37)27-22-12-6-9-15-25(22)39-29(27)36(26)30/h3-5,7-8,10-11,13-14H,2,6,9,12,15-20H2,1H3 |
| InChIKey | HTBIFBWSDLTJOZ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 67.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.69 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |