C19H19ClN5OS+ — CID 2015143
7-(3-chlorophenyl)-3-ethyl-13-methyl-16-thia-2,4,5,7-tetraza-13-azoniatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-8-one (PubChem CID 2015143) has the molecular formula C19H19ClN5OS+ and a molecular weight of 400.92 g/mol. Its IUPAC name is 7-(3-chlorophenyl)-3-ethyl-13-methyl-16-thia-2,4,5,7-tetraza-13-azoniatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-8-one.
| Compound Name | 7-(3-chlorophenyl)-3-ethyl-13-methyl-16-thia-2,4,5,7-tetraza-13-azoniatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-8-one |
|---|---|
| PubChem CID | 2015143 |
| Molecular Formula | C19H19ClN5OS+ |
| Molecular Weight | 400.92 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 7-(3-chlorophenyl)-3-ethyl-13-methyl-16-thia-2,4,5,7-tetraza-13-azoniatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-8-one |
| SMILES | CCc1nnc2n(-c3cccc(Cl)c3)c(=O)c3c4c(sc3n12)C[NH+](C)CC4 |
| InChI | InChI=1S/C19H18ClN5OS/c1-3-15-21-22-19-24(12-6-4-5-11(20)9-12)17(26)16-13-7-8-23(2)10-14(13)27-18(16)25(15)19/h4-6,9H,3,7-8,10H2,1-2H3/p+1 |
| InChIKey | SLGMXSAJMJFVGQ-UHFFFAOYSA-O |
| XLogP | 1.88 |
| TPSA | 56.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.92 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |