C18H16ClN5OS — CID 2015289
7-(3-chlorophenyl)-3,13-dimethyl-16-thia-2,4,5,7,13-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-8-one (PubChem CID 2015289) has the molecular formula C18H16ClN5OS and a molecular weight of 385.88 g/mol. Its IUPAC name is 7-(3-chlorophenyl)-3,13-dimethyl-16-thia-2,4,5,7,13-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-8-one.
| Compound Name | 7-(3-chlorophenyl)-3,13-dimethyl-16-thia-2,4,5,7,13-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-8-one |
|---|---|
| PubChem CID | 2015289 |
| Molecular Formula | C18H16ClN5OS |
| Molecular Weight | 385.88 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 7-(3-chlorophenyl)-3,13-dimethyl-16-thia-2,4,5,7,13-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-8-one |
| SMILES | Cc1nnc2n(-c3cccc(Cl)c3)c(=O)c3c4c(sc3n12)CN(C)CC4 |
| InChI | InChI=1S/C18H16ClN5OS/c1-10-20-21-18-23(10)17-15(13-6-7-22(2)9-14(13)26-17)16(25)24(18)12-5-3-4-11(19)8-12/h3-5,8H,6-7,9H2,1-2H3 |
| InChIKey | FQYGYWWWWGPEHF-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 55.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.88 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |