C24H20ClN5OS2 — CID 2012673
3-benzylsulfanyl-7-(3-chlorophenyl)-13-methyl-16-thia-2,4,5,7,13-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-8-one (PubChem CID 2012673) has the molecular formula C24H20ClN5OS2 and a molecular weight of 494.05 g/mol. Its IUPAC name is 3-benzylsulfanyl-7-(3-chlorophenyl)-13-methyl-16-thia-2,4,5,7,13-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-8-one.
| Compound Name | 3-benzylsulfanyl-7-(3-chlorophenyl)-13-methyl-16-thia-2,4,5,7,13-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-8-one |
|---|---|
| PubChem CID | 2012673 |
| Molecular Formula | C24H20ClN5OS2 |
| Molecular Weight | 494.05 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | 3-benzylsulfanyl-7-(3-chlorophenyl)-13-methyl-16-thia-2,4,5,7,13-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-8-one |
| SMILES | CN1CCc2c(sc3c2c(=O)n(-c2cccc(Cl)c2)c2nnc(SCc4ccccc4)n32)C1 |
| InChI | InChI=1S/C24H20ClN5OS2/c1-28-11-10-18-19(13-28)33-22-20(18)21(31)29(17-9-5-8-16(25)12-17)23-26-27-24(30(22)23)32-14-15-6-3-2-4-7-15/h2-9,12H,10-11,13-14H2,1H3 |
| InChIKey | CVAGGUUBPNWEDW-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 55.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.05 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |