C23H22ClN5O4S2 — CID 3813008
ethyl 2-[[7-(4-chlorophenyl)-13-methyl-8-oxo-16-thia-2,4,5,7,13-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-3-yl]sulfanyl]-3-oxobutanoate (PubChem CID 3813008) has the molecular formula C23H22ClN5O4S2 and a molecular weight of 532.05 g/mol. Its IUPAC name is ethyl 2-[[7-(4-chlorophenyl)-13-methyl-8-oxo-16-thia-2,4,5,7,13-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-3-yl]sulfanyl]-3-oxobutanoate.
| Compound Name | ethyl 2-[[7-(4-chlorophenyl)-13-methyl-8-oxo-16-thia-2,4,5,7,13-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-3-yl]sulfanyl]-3-oxobutanoate |
|---|---|
| PubChem CID | 3813008 |
| Molecular Formula | C23H22ClN5O4S2 |
| Molecular Weight | 532.05 g/mol |
| Exact Mass | 531.08 |
| IUPAC Name | ethyl 2-[[7-(4-chlorophenyl)-13-methyl-8-oxo-16-thia-2,4,5,7,13-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-3-yl]sulfanyl]-3-oxobutanoate |
| SMILES | CCOC(=O)C(Sc1nnc2n(-c3ccc(Cl)cc3)c(=O)c3c4c(sc3n12)CN(C)CC4)C(C)=O |
| InChI | InChI=1S/C23H22ClN5O4S2/c1-4-33-21(32)18(12(2)30)35-23-26-25-22-28(14-7-5-13(24)6-8-14)19(31)17-15-9-10-27(3)11-16(15)34-20(17)29(22)23/h5-8,18H,4,9-11H2,1-3H3 |
| InChIKey | QGBYSOAQRBQEPJ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 98.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.05 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|