C20H20ClN5O2S2 — CID 2025472
7-(4-chlorophenyl)-3-(2-methoxyethylsulfanyl)-13-methyl-16-thia-2,4,5,7,13-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-8-one (PubChem CID 2025472) has the molecular formula C20H20ClN5O2S2 and a molecular weight of 462.00 g/mol. Its IUPAC name is 7-(4-chlorophenyl)-3-(2-methoxyethylsulfanyl)-13-methyl-16-thia-2,4,5,7,13-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-8-one.
| Compound Name | 7-(4-chlorophenyl)-3-(2-methoxyethylsulfanyl)-13-methyl-16-thia-2,4,5,7,13-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-8-one |
|---|---|
| PubChem CID | 2025472 |
| Molecular Formula | C20H20ClN5O2S2 |
| Molecular Weight | 462.00 g/mol |
| Exact Mass | 461.07 |
| IUPAC Name | 7-(4-chlorophenyl)-3-(2-methoxyethylsulfanyl)-13-methyl-16-thia-2,4,5,7,13-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-8-one |
| SMILES | COCCSc1nnc2n(-c3ccc(Cl)cc3)c(=O)c3c4c(sc3n12)CN(C)CC4 |
| InChI | InChI=1S/C20H20ClN5O2S2/c1-24-8-7-14-15(11-24)30-18-16(14)17(27)25(13-5-3-12(21)4-6-13)19-22-23-20(26(18)19)29-10-9-28-2/h3-6H,7-11H2,1-2H3 |
| InChIKey | HLRFUWUKOJGBBA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 64.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.00 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|